* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FA 0026 |
English Synonyms: | RARECHEM AL FA 0026 |
MDL Number.: | MFCD00114787 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)/C(=C/C(=O)c2ccc(cc2)Cl)/CC(=O)c3ccc(cc3)Cl |
InChi: | InChI=1S/C23H16Cl2O2/c24-20-10-6-17(7-11-20)22(26)14-19(16-4-2-1-3-5-16)15-23(27)18-8-12-21(25)13-9-18/h1-14H,15H2/b19-14+ |
InChiKey: | InChIKey=OFQLHSBQJNVIHL-XMHGGMMESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.