* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,10-DIHYDRO-9,10-PHENANTHRENEDIOL |
English Synonyms: | 9,10-DIHYDRO-9,10-PHENANTHRENEDIOL |
MDL Number.: | MFCD00114918 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)-c3ccccc3C(C2O)O |
InChi: | InChI=1S/C14H12O2/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16/h1-8,13-16H |
InChiKey: | InChIKey=MFXNBQWUTDDOKE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.