* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-2-PHENYL-3,1-BENZOXAZIN-4-ONE |
| CAS: | 7033-52-5 |
| English Synonyms: | 7-CHLORO-2-PHENYL-3,1-BENZOXAZIN-4-ONE |
| MDL Number.: | MFCD00125880 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)c2nc3cc(ccc3c(=O)o2)Cl |
| InChi: | InChI=1S/C14H8ClNO2/c15-10-6-7-11-12(8-10)16-13(18-14(11)17)9-4-2-1-3-5-9/h1-8H |
| InChiKey: | InChIKey=PXIUCZXQBGRZNO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.