* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FE 0017 |
English Synonyms: | RARECHEM AL FE 0017 |
MDL Number.: | MFCD00126528 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc(ccc1C(=O)/C=C/[n+]2ccc(cc2)N3CCCC3)Cl.[Cl-] |
InChi: | InChI=1S/C18H18ClN2O.ClH/c19-16-5-3-15(4-6-16)18(22)9-14-20-12-7-17(8-13-20)21-10-1-2-11-21;/h3-9,12-14H,1-2,10-11H2;1H/q+1;/p-1/b14-9+; |
InChiKey: | InChIKey=ZYTBRSKPGGLLEE-KYIGKLDSSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.