* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL F1 4030 |
English Synonyms: | RARECHEM AL F1 4030 |
MDL Number.: | MFCD00126533 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cc(ccc1N/C=C\c2nnnn2c3ccc(cc3)Cl)O |
InChi: | InChI=1S/C15H12ClN5O/c16-11-1-5-13(6-2-11)21-15(18-19-20-21)9-10-17-12-3-7-14(22)8-4-12/h1-10,17,22H/b10-9- |
InChiKey: | InChIKey=FXNCVUBKPVRIGM-KTKRTIGZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.