* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL FG 0090 |
English Synonyms: | RARECHEM AL FG 0090 |
MDL Number.: | MFCD00126621 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C=CCS/C(=N\C#N)/S/C=C/C(=O)c1ccccc1 |
InChi: | InChI=1S/C14H12N2OS2/c1-2-9-18-14(16-11-15)19-10-8-13(17)12-6-4-3-5-7-12/h2-8,10H,1,9H2/b10-8+,16-14+ |
InChiKey: | InChIKey=WUAIMQCCXPDRPL-QBTNJIBQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.