* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00244783 |
| English Synonyms: | LABOTEST-BB LT00244783 |
| MDL Number.: | MFCD00127885 |
| H bond acceptor: | 14 |
| H bond donor: | 5 |
| Smile: | CCC1C(C(C(C(=O)C(CC(C(C(C(C(C(=O)O1)C)OC2CC(C(C(O2)C)O)(C)OC)C)OC3C(C(CC(O3)C)N(C)C)O)(C)O)C)C)O)(C)O |
| InChi: | InChI=1S/C37H67NO13/c1-14-25-37(10,45)30(41)20(4)27(39)18(2)16-35(8,44)32(51-34-28(40)24(38(11)12)15-19(3)47-34)21(5)29(22(6)33(43)49-25)50-26-17-36(9,46-13)31(42)23(7)48-26/h18-26,28-32,34,40-42,44-45H,14-17H2,1-13H3 |
| InChiKey: | InChIKey=ULGZDMOVFRHVEP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.