* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9ALPHA-HYDROXY-8,13-EPOXY-LABD-14-EN-11-ONE |
CAS: | 72963-78-1 |
English Synonyms: | COLEOL ; 9ALPHA-HYDROXY-8,13-EPOXY-LABD-14-EN-11-ONE |
MDL Number.: | MFCD00133015 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC1(CCC[C@]2([C@H]1CC[C@@]3([C@@]2(C(=O)C[C@](O3)(C)C=C)O)C)C)C |
InChi: | InChI=1S/C20H32O3/c1-7-17(4)13-15(21)20(22)18(5)11-8-10-16(2,3)14(18)9-12-19(20,6)23-17/h7,14,22H,1,8-13H2,2-6H3/t14-,17-,18-,19+,20-/m0/s1 |
InChiKey: | InChIKey=NDROUXDZPPPVIM-UPWFSPPHSA-N |
Property |
|
Safety information |
|
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.