* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LACTIC ACID SODIUM SALT DL-[1-14C] |
CAS: | 70147-17-0 ;2058-38-0 |
English Synonyms: | LACTIC ACID SODIUM SALT DL-[1-14C] |
MDL Number.: | MFCD00133281 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC([14C](=O)[O-])O.[Na+] |
InChi: | InChI=1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1/i3+2; |
InChiKey: | InChIKey=NGSFWBMYFKHRBD-REVVOINZSA-M |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.