* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VAL-THR-LYS-GLY |
CAS: | 133605-54-6 |
English Synonyms: | VAL-THR-LYS-GLY |
MDL Number.: | MFCD00133918 |
H bond acceptor: | 11 |
H bond donor: | 7 |
Smile: | CC(C)[C@@H](C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)O)N |
InChi: | InChI=1S/C17H33N5O6/c1-9(2)13(19)16(27)22-14(10(3)23)17(28)21-11(6-4-5-7-18)15(26)20-8-12(24)25/h9-11,13-14,23H,4-8,18-19H2,1-3H3,(H,20,26)(H,21,28)(H,22,27)(H,24,25)/t10-,11+,13+,14+/m1/s1 |
InChiKey: | InChIKey=DQPMXYDFWRYWQV-XWUBHJNHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.