* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZINC FERROCYANIDE |
| CAS: | 14883-46-6 |
| English Synonyms: | ZINC FERROCYANIDE |
| MDL Number.: | MFCD00134713 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | C(#N)[Fe-4](C#N)(C#N)(C#N)(C#N)C#N.[Zn+2].[Zn+2] |
| InChi: | InChI=1S/6CN.Fe.2Zn/c6*1-2;;;/q;;;;;;-4;2*+2 |
| InChiKey: | InChIKey=WAKSVJXHODCXTR-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.