* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-GAMMA-GLU-ABU-OH |
CAS: | 16869-42-4 |
English Synonyms: | H-GAMMA-GLU-ABU-OH ; H-GLU(ABU-OH)-OH |
MDL Number.: | MFCD00134892 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | CC[C@@H](C(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
InChi: | InChI=1S/C9H16N2O5/c1-2-6(9(15)16)11-7(12)4-3-5(10)8(13)14/h5-6H,2-4,10H2,1H3,(H,11,12)(H,13,14)(H,15,16)/t5-,6-/m0/s1 |
InChiKey: | InChIKey=FUZOZPRKGAXGOB-WDSKDSINSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.