* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-VAL-VAL-GLN-OH |
English Synonyms: | L-VAL-VAL-GLN ; H-VAL-VAL-GLN-OH |
MDL Number.: | MFCD00134917 |
H bond acceptor: | 9 |
H bond donor: | 5 |
Smile: | CC(C)[C@@H](C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(=O)N)C(=O)O)N |
InChi: | InChI=1S/C15H28N4O5/c1-7(2)11(17)13(21)19-12(8(3)4)14(22)18-9(15(23)24)5-6-10(16)20/h7-9,11-12H,5-6,17H2,1-4H3,(H2,16,20)(H,18,22)(H,19,21)(H,23,24)/t9-,11-,12-/m0/s1 |
InChiKey: | InChIKey=VVIZITNVZUAEMI-DLOVCJGASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.