* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-TRP-SER-PHE NH2 |
English Synonyms: | L-TRP-SER-PHE NH2 |
MDL Number.: | MFCD00134924 |
H bond acceptor: | 9 |
H bond donor: | 6 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)N)NC(=O)[C@H](CO)NC(=O)[C@H](Cc2c[nH]c3c2cccc3)N |
InChi: | InChI=1S/C23H27N5O4/c24-17(11-15-12-26-18-9-5-4-8-16(15)18)22(31)28-20(13-29)23(32)27-19(21(25)30)10-14-6-2-1-3-7-14/h1-9,12,17,19-20,26,29H,10-11,13,24H2,(H2,25,30)(H,27,32)(H,28,31)/t17-,19-,20-/m0/s1 |
InChiKey: | InChIKey=CJPSVXOHQREJFH-IHPCNDPISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.