* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,15-DIOXO-PROSTA-5Z,10-DIEN-1-OIC ACID |
CAS: | 74872-89-2 |
English Synonyms: | 9,15-DIOXO-PROSTA-5Z,10-DIEN-1-OIC ACID ; 13,14-DIHYDRO-15-KETO PROSTAGLANDIN A2 |
MDL Number.: | MFCD00135204 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCCCC(=O)CC[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
InChi: | InChI=1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,7,13,15-16,18H,2-3,5-6,8-12,14H2,1H3,(H,23,24)/b7-4-/t16-,18+/m0/s1 |
InChiKey: | InChIKey=FMKLAIBZMCURLI-BFVRRIQPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.