Molecular Structure:
CCD No.:CCD00065678
L-ORNITHINE-[2,3-3H]
CAS No.:
128551-39-3
Formula:C5 H10 N2 O2 T2
MolWeight:136.178
![L-ORNITHINE-[2,3-3H] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | L-ORNITHINE-[2,3-3H] |
| CAS： | 128551-39-3 |
| English Synonyms： | L-ORNITHINE HYDROCHLORIDE, [2,3-3H]- ; L-ORNITHINE-[2,3-3H] |
| MDL Number.： | MFCD00135798 |
| H bond acceptor： | 4 |
| H bond donor： | 3 |
| Smile： | [3H]C(CCN)[C@@]([3H])(C(=O)O)N |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
