* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RHODINYL FORMATE |
English Synonyms: | RHODINYL FORMATE |
MDL Number.: | MFCD00135977 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C[C@@H](CCCC(=C)C)CCOC=O |
InChi: | InChI=1S/C11H20O2/c1-10(2)5-4-6-11(3)7-8-13-9-12/h9,11H,1,4-8H2,2-3H3/t11-/m0/s1 |
InChiKey: | InChIKey=VMBKZHMLQXCNCP-NSHDSACASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.