* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZIRCONIUM LACTATE |
| CAS: | 60676-90-6 |
| English Synonyms: | ZIRCONIUM LACTATE |
| MDL Number.: | MFCD00135985 |
| H bond acceptor: | 12 |
| H bond donor: | 4 |
| Smile: | CC(C(=O)O[Zr](OC(=O)C(C)O)(OC(=O)C(C)O)OC(=O)C(C)O)O |
| InChi: | InChI=1S/4C3H6O3.Zr/c4*1-2(4)3(5)6;/h4*2,4H,1H3,(H,5,6);/q;;;;+4/p-4 |
| InChiKey: | InChIKey=LYPJRFIBDHNQLY-UHFFFAOYSA-J |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.