* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1358561 |
English Synonyms: | OTAVA-BB 1358561 |
MDL Number.: | MFCD00136224 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc(c(c1)NC(=O)/C=C\C(=O)O)S |
InChi: | InChI=1S/C10H9NO3S/c12-9(5-6-10(13)14)11-7-3-1-2-4-8(7)15/h1-6,15H,(H,11,12)(H,13,14)/b6-5- |
InChiKey: | InChIKey=LKLMQUNWQWPKES-WAYWQWQTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.