* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-HIS-TYR-OH |
| CAS: | 17257-63-5 |
| English Synonyms: | Z-HIS-TYR-OH ; Z-L-HISTIDYL-L-TYROSINE |
| MDL Number.: | MFCD00136494 |
| H bond acceptor: | 10 |
| H bond donor: | 5 |
| Smile: | c1ccc(cc1)COC(=O)N[C@@H](Cc2c[nH]cn2)C(=O)N[C@@H](Cc3ccc(cc3)O)C(=O)O |
| InChi: | InChI=1S/C23H24N4O6/c28-18-8-6-15(7-9-18)10-20(22(30)31)26-21(29)19(11-17-12-24-14-25-17)27-23(32)33-13-16-4-2-1-3-5-16/h1-9,12,14,19-20,28H,10-11,13H2,(H,24,25)(H,26,29)(H,27,32)(H,30,31)/t19-,20-/m0/s1 |
| InChiKey: | InChIKey=QHPSWBYUIKSQHA-PMACEKPBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.