* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-BETA-ALA-VAL-OH |
CAS: | 17136-26-4 |
English Synonyms: | H-BETA-ALA-VAL-OH |
MDL Number.: | MFCD00136511 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC(C)[C@@H](C(=O)O)NC(=O)CCN |
InChi: | InChI=1S/C8H16N2O3/c1-5(2)7(8(12)13)10-6(11)3-4-9/h5,7H,3-4,9H2,1-2H3,(H,10,11)(H,12,13)/t7-/m0/s1 |
InChiKey: | InChIKey=DVIZUEAPVZZYCO-ZETCQYMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.