* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-TYR-TYR-NH2 HCL |
| CAS: | 98758-81-7 |
| English Synonyms: | H-TYR-TYR-NH2 HCL |
| MDL Number.: | MFCD00136600 |
| H bond acceptor: | 7 |
| H bond donor: | 5 |
| Smile: | c1cc(ccc1C[C@@H](C(=O)N[C@@H](Cc2ccc(cc2)O)C(=O)N)N)O.Cl |
| InChi: | InChI=1S/C18H21N3O4.ClH/c19-15(9-11-1-5-13(22)6-2-11)18(25)21-16(17(20)24)10-12-3-7-14(23)8-4-12;/h1-8,15-16,22-23H,9-10,19H2,(H2,20,24)(H,21,25);1H/t15-,16-;/m0./s1 |
| InChiKey: | InChIKey=PYUFRIUZRAOFSI-MOGJOVFKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.