* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-TRP-GLY-OH |
| CAS: | 17388-70-4 |
| English Synonyms: | Z-TRP-GLY-OH ; Z-L-TRYPTOPHYL-GLYCINE |
| MDL Number.: | MFCD00136604 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | c1ccc(cc1)COC(=O)N[C@@H](Cc2c[nH]c3c2cccc3)C(=O)NCC(=O)O |
| InChi: | InChI=1S/C21H21N3O5/c25-19(26)12-23-20(27)18(10-15-11-22-17-9-5-4-8-16(15)17)24-21(28)29-13-14-6-2-1-3-7-14/h1-9,11,18,22H,10,12-13H2,(H,23,27)(H,24,28)(H,25,26)/t18-/m0/s1 |
| InChiKey: | InChIKey=CKMNNKBYQJXRAB-SFHVURJKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.