* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-D-TRP-OH |
| English Synonyms: | Z-GLY-D-TRP-OH |
| MDL Number.: | MFCD00136730 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | c1ccc(cc1)COC(=O)NCC(=O)N[C@H](Cc2c[nH]c3c2cccc3)C(=O)O |
| InChi: | InChI=1S/C21H21N3O5/c25-19(12-23-21(28)29-13-14-6-2-1-3-7-14)24-18(20(26)27)10-15-11-22-17-9-5-4-8-16(15)17/h1-9,11,18,22H,10,12-13H2,(H,23,28)(H,24,25)(H,26,27)/t18-/m1/s1 |
| InChiKey: | InChIKey=VFJWAPSFRKFYME-GOSISDBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.