* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-PHE-SER-OME |
| CAS: | 23828-09-3 |
| English Synonyms: | Z-PHE-SER-OME |
| MDL Number.: | MFCD00136733 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | COC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C21H24N2O6/c1-28-20(26)18(13-24)22-19(25)17(12-15-8-4-2-5-9-15)23-21(27)29-14-16-10-6-3-7-11-16/h2-11,17-18,24H,12-14H2,1H3,(H,22,25)(H,23,27)/t17-,18-/m0/s1 |
| InChiKey: | InChIKey=QWRVHVAOTRUOLA-ROUUACIJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.