* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7,11-HEXADECADIEN-1-OL,1-ACETATE |
| CAS: | 50933-33-0 |
| English Synonyms: | 7,11-HEXADECADIEN-1-YL ACETATE ; 7,11-HEXADECADIEN-1-OL,1-ACETATE |
| MDL Number.: | MFCD00137380 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCCC/C=C/CC/C=C/CCCCCCOC(=O)C |
| InChi: | InChI=1S/C18H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h6-7,10-11H,3-5,8-9,12-17H2,1-2H3/b7-6+,11-10+ |
| InChiKey: | InChIKey=BXJHOKLLMOYSRQ-MVQNEBOGSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.