* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(4-FLUOROSTYRYL)[1,2,4]TRIAZOLO[1,5-A]PYRIMIDINE |
| English Synonyms: | 7-(4-FLUOROSTYRYL)[1,2,4]TRIAZOLO[1,5-A]PYRIMIDINE |
| MDL Number.: | MFCD00138737 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1cc(ccc1/C=C/c2ccnc3n2ncn3)F |
| InChi: | InChI=1S/C13H9FN4/c14-11-4-1-10(2-5-11)3-6-12-7-8-15-13-16-9-17-18(12)13/h1-9H/b6-3+ |
| InChiKey: | InChIKey=RLUJXPKHISIJOX-ZZXKWVIFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.