* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ACET-D3-ANILIDE |
| CAS: | 6710-72-1 |
| English Synonyms: | ACET-D3-ANILIDE |
| MDL Number.: | MFCD00143530 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | [2H]C([2H])([2H])C(=O)NC1=CC=CC=C1 |
| InChi: | InChI=1S/C8H9NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10)/i1D3 |
| InChiKey: | InChIKey=FZERHIULMFGESH-FIBGUPNXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.