Molecular Structure:
CCD No.:CCD00071601
DL-ASPARTIC ACID-2,3,3-D3
CAS No.:
14341-75-4
Formula:C4 H4 D3 N O4
MolWeight:136.121
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | DL-ASPARTIC ACID-2,3,3-D3 |
| CAS： | 14341-75-4 |
| English Synonyms： | DL-ASPARTIC-2,3,3-D3 ACID ; DL-ASPARTIC ACID-2,3,3-D3 |
| MDL Number.： | MFCD00144167 |
| H bond acceptor： | 5 |
| H bond donor： | 3 |
| Smile： | [2H]C([2H])(C(=O)O)C([2H])(C(=O)O)N |
| InChiKey： | InChIKey=null |
|
|
| Melting Point： | >300 DEG C (DEC)(LIT) |
| Comments： | MASS SHIFT: M+3 WGK: 3 |
| Information： | ISOTOPIC PURITY: 98 ATOM % D MW: 136.07 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
