Molecular Structure:
CCD No.:CCD00071728
GLYCINE-N-T-BOC (2,2-D2)
Formula:C6 H11 D2 N O2
MolWeight:133.186
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | GLYCINE-N-T-BOC (2,2-D2) |
| English Synonyms： | GLYCINE-N-T-BOC (2,2-D2) |
| MDL Number.： | MFCD00144401 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | [2H]C([2H])(C(=O)O)NC(C)(C)C |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
