* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLYPHOSATE-3-13C |
| CAS: | 287399-30-8 |
| English Synonyms: | GLYPHOSATE-3-13C |
| MDL Number.: | MFCD00144404 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | C(C(=O)O)N[13CH2]OP(=O)O |
| InChi: | InChI=1S/C3H8NO5P/c5-3(6)1-4-2-9-10(7)8/h4,10H,1-2H2,(H,5,6)(H,7,8)/i2+1 |
| InChiKey: | InChIKey=PORYNWWXXSDTBV-VQEHIDDOSA-N |
|
|
| Melting Point: | 230 DEG C (DEC)(LIT) |
| Comments: | MASS SHIFT: M+1 RIDADR: UN 3077 9/PG 3 WGK: 2 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 170.06 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.