* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GUAIACOL (RING-13C6) |
| English Synonyms: | GUAIACOL (RING-13C6) ; 2-METHOXYPHENOL (RING-13C6) |
| MDL Number.: | MFCD00144416 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CO[13c]1[13cH][13cH][13cH][13cH][13c]1O |
| InChi: | InChI=1S/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3/i2+1,3+1,4+1,5+1,6+1,7+1 |
| InChiKey: | InChIKey=LHGVFZTZFXWLCP-WBJZHHNVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.