* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDOLE-3-ACETIC ACID (PHENYL-13C6) |
English Synonyms: | INDOLE-3-ACETIC ACID (PHENYL-13C6) |
MDL Number.: | MFCD00144482 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1c([13c]2[13cH][13cH][13cH][13cH][13c]2[nH]1)CC(=O)O |
InChi: | InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/i1+1,2+1,3+1,4+1,8+1,9+1 |
InChiKey: | InChIKey=SEOVTRFCIGRIMH-MROVPUMUSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.