* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-ALANINE-N-T-BOC (2-13C) |
English Synonyms: | L-ALANINE-N-T-BOC (2-13C) |
MDL Number.: | MFCD00144539 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C[13C@@H](C(=O)O)NC(C)(C)C |
InChi: | InChI=1S/C7H15NO2/c1-5(6(9)10)8-7(2,3)4/h5,8H,1-4H3,(H,9,10)/t5-/m0/s1/i5+1 |
InChiKey: | InChIKey=MRTPISKDZDHEQI-IJPZVAHNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.