* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-ARGININE HCL (GUANIDO-15N2) |
English Synonyms: | L-ARGININE HCL (GUANIDO-15N2) |
MDL Number.: | MFCD00144557 |
H bond acceptor: | 6 |
H bond donor: | 5 |
Smile: | C(C[C@@H](C(=O)O)N)CNC(=[15NH])[15NH2].Cl |
InChi: | InChI=1S/C6H14N4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/m0./s1/i8+1,9+1; |
InChiKey: | InChIKey=KWTQSFXGGICVPE-SXTJCFDNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.