* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-ARGININE HCL (U-13C6; U-15N4) |
English Synonyms: | L-ARGININE HCL (U-13C6; U-15N4) |
MDL Number.: | MFCD00144560 |
H bond acceptor: | 6 |
H bond donor: | 5 |
Smile: | [13CH2]([13CH2][13C@@H]([13C](=O)O)[15NH2])[13CH2][15NH][13C](=[15NH])[15NH2] |
InChi: | InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1 |
InChiKey: | InChIKey=ODKSFYDXXFIFQN-GZYYCROJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.