* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-PROLINE-N-T-BOC (15N) |
| English Synonyms: | L-PROLINE-N-T-BOC (15N) |
| MDL Number.: | MFCD00144669 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)[15N]1CCC[C@H]1C(=O)O |
| InChi: | InChI=1S/C9H17NO2/c1-9(2,3)10-6-4-5-7(10)8(11)12/h7H,4-6H2,1-3H3,(H,11,12)/t7-/m0/s1/i10+1 |
| InChiKey: | InChIKey=SFMPOAWDFHFSEN-AKOQEDMSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.