* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-PROLINE (U-13C5) |
| English Synonyms: | L-PROLINE (U-13C5) ; L-PROLINE-13C5 |
| MDL Number.: | MFCD00144670 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | [13CH2]1[13CH2][13C@H](N[13CH2]1)[13C](=O)O |
| InChi: | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1/i1+1,2+1,3+1,4+1,5+1 |
| InChiKey: | InChIKey=ONIBWKKTOPOVIA-JRGPAWSWSA-N |
|
|
| Melting Point: | 228 DEG C (DEC)(LIT) |
| Comments: | MASS SHIFT: M+5 OPTICAL ACTIVITY: [ALPHA]25/D -86.0 DEG, C = 2 IN H2O WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 120.04 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.