Molecular Structure:
CCD No.:CCD00071897
L-SERINE-2,3,3-D3
CAS No.:
105591-10-4
Formula:C3 H4 D3 N O3
MolWeight:108.111
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | L-SERINE-2,3,3-D3 |
| CAS： | 105591-10-4 |
| English Synonyms： | L-SERINE-2,3,3-D3 |
| MDL Number.： | MFCD00144674 |
| H bond acceptor： | 4 |
| H bond donor： | 3 |
| Smile： | [2H]C([2H])([C@@]([2H])(C(=O)O)N)O |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
