* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-SERINE-N-T-BOC, O-BENZYL ETHER (15N) |
| English Synonyms: | L-SERINE-N-T-BOC, O-BENZYL ETHER (15N) |
| MDL Number.: | MFCD00144675 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)[15NH][C@@H](COCc1ccccc1)C(=O)O |
| InChi: | InChI=1S/C14H21NO3/c1-14(2,3)15-12(13(16)17)10-18-9-11-7-5-4-6-8-11/h4-8,12,15H,9-10H2,1-3H3,(H,16,17)/t12-/m0/s1/i15+1 |
| InChiKey: | InChIKey=FFIKFBGYMKSJFO-XXOGGYJESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.