Molecular Structure:
CCD No.:CCD00071902
L-THREONINE-2,3,4,4,4-D5
Formula:C4 H4 D5 N O3
MolWeight:124.15
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | L-THREONINE-2,3,4,4,4-D5 |
| English Synonyms： | L-THREONINE-D5 ; L-THREONINE-2,3,4,4,4-D5 |
| MDL Number.： | MFCD00144680 |
| H bond acceptor： | 4 |
| H bond donor： | 3 |
| Smile： | [2H]C([2H])([2H])[C@]([2H])([C@@]([2H])(C(=O)O)N)O |
| InChiKey： | InChIKey=null |
|
|
| Melting Point： | 256 DEG C (DEC) |
| Comments： | ASSAY METHOD: CP MASS SHIFT: M+5 WGK: 3 |
| Information： | ISOTOPIC PURITY: 98 ATOM % D MW: 124.05 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
