Molecular Structure:
CCD No.:CCD00071903
L-THREONINE (U-13C4)
Formula:C4 H9 N O3
MolWeight:123.075
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | L-THREONINE (U-13C4) |
| English Synonyms： | L-THREONINE-13C4 ; L-THREONINE (U-13C4) |
| MDL Number.： | MFCD00144681 |
| H bond acceptor： | 4 |
| H bond donor： | 3 |
| Smile： | [13CH3][13C@H]([13C@@H]([13C](=O)O)N)O |
| InChi： | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1/i1+1,2+1,3+1,4+1 |
| InChiKey： | InChIKey=AYFVYJQAPQTCCC-GGLUNYCGSA-N |
|
|
| Melting Point： | 256 DEG C(DEC) |
| Comments： | ASSAY METHOD: CP |
| Information： | ISOTOPIC PURITY: 98 ATOM % 13C MW: 123.01 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
