Molecular Structure:
CCD No.:CCD00071908
L-TRYPTOPHAN (INDOLE-3-13C)
Formula:C11 H12 N2 O2
MolWeight:205.217
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | L-TRYPTOPHAN (INDOLE-3-13C) |
| English Synonyms： | L-TRYPTOPHAN-(INDOLE RING-2-13C) ; L-TRYPTOPHAN (INDOLE-3-13C) |
| MDL Number.： | MFCD00144686 |
| H bond acceptor： | 4 |
| H bond donor： | 3 |
| Smile： | c1ccc2c(c1)[13c](c[nH]2)C[C@@H](C(=O)O)N |
| InChi： | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i7+1 |
| InChiKey： | InChIKey=QIVBCDIJIAJPQS-WQVCYBKOSA-N |
|
|
| Melting Point： | 280-285 DEG C (DEC)(LIT) |
| Comments： | MASS SHIFT: M+1 OPTICAL ACTIVITY: [ALPHA]20/D -30.5 DEG, C = 1 IN H2O WGK: 1 |
| Information： | ISOTOPIC PURITY: 99 ATOM % 13C MW: 205.22 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
