* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-TRYPTOPHAN (INDOLE-4-13C) |
| English Synonyms: | L-TRYPTOPHAN (INDOLE-4-13C) |
| MDL Number.: | MFCD00144687 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1c[13cH]c2c(c1)[nH]cc2C[C@@H](C(=O)O)N |
| InChi: | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i3+1 |
| InChiKey: | InChIKey=QIVBCDIJIAJPQS-MAMLIDCWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.