* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-TYROSINE-N-T-BOC, O-BENZYL ETHER (RING-13C6) |
| English Synonyms: | L-TYROSINE-N-T-BOC, O-BENZYL ETHER (RING-13C6) |
| MDL Number.: | MFCD00144692 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)N[C@@H](C[13c]1[13cH][13cH][13c]([13cH][13cH]1)OCc2ccccc2)C(=O)O |
| InChi: | InChI=1S/C20H25NO3/c1-20(2,3)21-18(19(22)23)13-15-9-11-17(12-10-15)24-14-16-7-5-4-6-8-16/h4-12,18,21H,13-14H2,1-3H3,(H,22,23)/t18-/m0/s1/i9+1,10+1,11+1,12+1,15+1,17+1 |
| InChiKey: | InChIKey=CLFJZDOKBICHBO-DECIBRHVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.