* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-TYROSINE (PHENOL-3,5-13C2) |
| English Synonyms: | L-TYROSINE (PHENOL-3,5-13C2) |
| MDL Number.: | MFCD00144695 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1[13cH]c([13cH]cc1C[C@@H](C(=O)O)N)O |
| InChi: | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i3+1,4+1 |
| InChiKey: | InChIKey=OUYCCCASQSFEME-ALJHITAUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.