* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-VALINE-N-T-BOC (15N) |
| English Synonyms: | L-VALINE-N-T-BOC (15N) |
| MDL Number.: | MFCD00144706 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CC(C)[C@@H](C(=O)O)[15NH]C(C)(C)C |
| InChi: | InChI=1S/C9H19NO2/c1-6(2)7(8(11)12)10-9(3,4)5/h6-7,10H,1-5H3,(H,11,12)/t7-/m0/s1/i10+1 |
| InChiKey: | InChIKey=FLAMJKCIVJROHA-AKOQEDMSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.