Molecular Structure:
CCD No.:CCD00071926
L-VALINE (U-13C5)
Formula:C5 H11 N O2
MolWeight:122.092
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | L-VALINE (U-13C5) |
| English Synonyms： | L-VALINE-13C5 ; L-VALINE (U-13C5) |
| MDL Number.： | MFCD00144707 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | [13CH3][13CH]([13CH3])[13C@@H]([13C](=O)O)N |
| InChi： | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1/i1+1,2+1,3+1,4+1,5+1 |
| InChiKey： | InChIKey=KZSNJWFQEVHDMF-JRGPAWSWSA-N |
|
|
| Melting Point： | 295-300 DEG C(LIT) |
| Comments： | ASSAY METHOD: CP WGK: 1 |
| Information： | ISOTOPIC PURITY: 99 ATOM % 13C MW: 122.06 BY ATOM % CALCULATION |
|
|
| WGK Germany： | 1 |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
