* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-VALINE (U-13C5) |
English Synonyms: | L-VALINE (U-13C5) ; L-VALINE-13C5 |
MDL Number.: | MFCD00144707 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | [13CH3][13CH]([13CH3])[13C@@H]([13C](=O)O)N |
InChi: | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1/i1+1,2+1,3+1,4+1,5+1 |
InChiKey: | InChIKey=KZSNJWFQEVHDMF-JRGPAWSWSA-N |
Property |
|
Melting Point: | 295-300 DEG C(LIT) |
Comments: | ASSAY METHOD: CP WGK: 1 |
Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 122.06 BY ATOM % CALCULATION |
Safety information |
|
WGK Germany: | 1 |
* If the product has intellectual property rights, a license granted is must or contact us.