Molecular Structure:
CCD No.:CCD00072131
OLEIC ACID (D33)
Formula:C18 H D33 O2
MolWeight:315.666
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OLEIC ACID (D33) |
| English Synonyms： | OLEIC ACID (D33) |
| MDL Number.： | MFCD00145034 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | [2H]/C(=C(/[2H])\C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])/C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
