* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OROTIC ACID (1,3-15N2) |
| English Synonyms: | OROTIC ACID (1,3-15N2) |
| MDL Number.: | MFCD00145042 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | C1C(=[15N]C(=O)[15NH]C1=O)C(=O)O |
| InChi: | InChI=1S/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H2,(H,9,10)(H,7,8,11)/i6+1,7+1 |
| InChiKey: | InChIKey=WAKGPBXZGKVQRR-AKZCFXPHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.